C23H18ClF3N4 — CID 27108783
2-[(Z)-3-(4-chlorophenyl)-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]prop-2-enylidene]propanedinitrile (PubChem CID 27108783) has the molecular formula C23H18ClF3N4 and a molecular weight of 442.87 g/mol. Its IUPAC name is 2-[(Z)-3-(4-chlorophenyl)-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]prop-2-enylidene]propanedinitrile.
| Compound Name | 2-[(Z)-3-(4-chlorophenyl)-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]prop-2-enylidene]propanedinitrile |
|---|---|
| PubChem CID | 27108783 |
| Molecular Formula | C23H18ClF3N4 |
| Molecular Weight | 442.87 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 2-[(Z)-3-(4-chlorophenyl)-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]prop-2-enylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C/C=C(/c1ccc(Cl)cc1)N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C23H18ClF3N4/c24-20-7-5-18(6-8-20)22(9-4-17(15-28)16-29)31-12-10-30(11-13-31)21-3-1-2-19(14-21)23(25,26)27/h1-9,14H,10-13H2/b22-9- |
| InChIKey | UYLSWJGUKLEFKI-AFPJDJCSSA-N |
| XLogP | 5.50 |
| TPSA | 54.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.87 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|