C22H15FNO5- — CID 2712431
5-[[4-[(E)-2-cyano-2-(4-fluorophenyl)ethenyl]-2-methoxyphenoxy]methyl]furan-2-carboxylate (PubChem CID 2712431) has the molecular formula C22H15FNO5- and a molecular weight of 392.36 g/mol. Its IUPAC name is 5-[[4-[(E)-2-cyano-2-(4-fluorophenyl)ethenyl]-2-methoxyphenoxy]methyl]furan-2-carboxylate.
| Compound Name | 5-[[4-[(E)-2-cyano-2-(4-fluorophenyl)ethenyl]-2-methoxyphenoxy]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 2712431 |
| Molecular Formula | C22H15FNO5- |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 5-[[4-[(E)-2-cyano-2-(4-fluorophenyl)ethenyl]-2-methoxyphenoxy]methyl]furan-2-carboxylate |
| SMILES | COc1cc(/C=C(/C#N)c2ccc(F)cc2)ccc1OCc1ccc(C(=O)[O-])o1 |
| InChI | InChI=1S/C22H16FNO5/c1-27-21-11-14(10-16(12-24)15-3-5-17(23)6-4-15)2-8-19(21)28-13-18-7-9-20(29-18)22(25)26/h2-11H,13H2,1H3,(H,25,26)/p-1/b16-10- |
| InChIKey | OBFVZGKWVQGPIN-YBEGLDIGSA-M |
| XLogP | 3.43 |
| TPSA | 95.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|