C24H22N4S2 — CID 27161256
N-phenyl-3-[2-(phenylcarbamothioylamino)ethyl]indole-1-carbothioamide (PubChem CID 27161256) has the molecular formula C24H22N4S2 and a molecular weight of 430.60 g/mol. Its IUPAC name is N-phenyl-3-[2-(phenylcarbamothioylamino)ethyl]indole-1-carbothioamide.
| Compound Name | N-phenyl-3-[2-(phenylcarbamothioylamino)ethyl]indole-1-carbothioamide |
|---|---|
| PubChem CID | 27161256 |
| Molecular Formula | C24H22N4S2 |
| Molecular Weight | 430.60 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | N-phenyl-3-[2-(phenylcarbamothioylamino)ethyl]indole-1-carbothioamide |
| SMILES | S=C(NCCc1cn(C(=S)Nc2ccccc2)c2ccccc12)Nc1ccccc1 |
| InChI | InChI=1S/C24H22N4S2/c29-23(26-19-9-3-1-4-10-19)25-16-15-18-17-28(22-14-8-7-13-21(18)22)24(30)27-20-11-5-2-6-12-20/h1-14,17H,15-16H2,(H,27,30)(H2,25,26,29) |
| InChIKey | RTLDZPJMGLUVBC-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 41.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.60 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|