C24H23F2N3O5 — CID 27191814
[2-[2-[4-(difluoromethoxy)phenyl]ethylamino]-2-oxoethyl] 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetate (PubChem CID 27191814) has the molecular formula C24H23F2N3O5 and a molecular weight of 471.46 g/mol. Its IUPAC name is [2-[2-[4-(difluoromethoxy)phenyl]ethylamino]-2-oxoethyl] 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetate.
| Compound Name | [2-[2-[4-(difluoromethoxy)phenyl]ethylamino]-2-oxoethyl] 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetate |
|---|---|
| PubChem CID | 27191814 |
| Molecular Formula | C24H23F2N3O5 |
| Molecular Weight | 471.46 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | [2-[2-[4-(difluoromethoxy)phenyl]ethylamino]-2-oxoethyl] 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetate |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C(=O)C(=O)OCC(=O)NCCc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C24H23F2N3O5/c1-15-21(16(2)29(28-15)18-6-4-3-5-7-18)22(31)23(32)33-14-20(30)27-13-12-17-8-10-19(11-9-17)34-24(25)26/h3-11,24H,12-14H2,1-2H3,(H,27,30) |
| InChIKey | WAVOVAYVFLKTAP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|