C20H24N4O5 — CID 27191607
[2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetate (PubChem CID 27191607) has the molecular formula C20H24N4O5 and a molecular weight of 400.44 g/mol. Its IUPAC name is [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetate.
| Compound Name | [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetate |
|---|---|
| PubChem CID | 27191607 |
| Molecular Formula | C20H24N4O5 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetate |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C(=O)C(=O)OCC(=O)NC(=O)NCC(C)C |
| InChI | InChI=1S/C20H24N4O5/c1-12(2)10-21-20(28)22-16(25)11-29-19(27)18(26)17-13(3)23-24(14(17)4)15-8-6-5-7-9-15/h5-9,12H,10-11H2,1-4H3,(H2,21,22,25,28) |
| InChIKey | UJTISWYELSLIFO-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|