About methyl N-(3-chlorophenyl)-N'-methylcarbamimidothioate
methyl N-(3-chlorophenyl)-N'-methylcarbamimidothioate (PubChem CID 2725135) has the molecular formula C9H11ClN2S
and a molecular weight of 214.72 g/mol. Its IUPAC name is methyl N-(3-chlorophenyl)-N'-methylcarbamimidothioate.
Molecular Properties
| Compound Name | methyl N-(3-chlorophenyl)-N'-methylcarbamimidothioate |
| PubChem CID | 2725135 |
| Molecular Formula | C9H11ClN2S |
| Molecular Weight | 214.72 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | methyl N-(3-chlorophenyl)-N'-methylcarbamimidothioate |
| SMILES | C/N=C(/Nc1cccc(Cl)c1)SC |
| InChI | InChI=1S/C9H11ClN2S/c1-11-9(13-2)12-8-5-3-4-7(10)6-8/h3-6H,1-2H3,(H,11,12) |
| InChIKey | KTCBIOZDBIFEMI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.72 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl N-(3-chlorophenyl)-N'-methylcarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-(3-chlorophenyl)-N'-methylcarbamimidothioate?
The IUPAC name of methyl N-(3-chlorophenyl)-N'-methylcarbamimidothioate (CID 2725135) is methyl N-(3-chlorophenyl)-N'-methylcarbamimidothioate.
What is the SMILES notation for methyl N-(3-chlorophenyl)-N'-methylcarbamimidothioate?
The canonical SMILES for methyl N-(3-chlorophenyl)-N'-methylcarbamimidothioate is C/N=C(/Nc1cccc(Cl)c1)SC.
What is the InChIKey of methyl N-(3-chlorophenyl)-N'-methylcarbamimidothioate?
The InChIKey is KTCBIOZDBIFEMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClN2S/c1-11-9(13-2)12-8-5-3-4-7(10)6-8/h3-6H,1-2H3,(H,11,12).
What are the key properties of methyl N-(3-chlorophenyl)-N'-methylcarbamimidothioate?
methyl N-(3-chlorophenyl)-N'-methylcarbamimidothioate has a molecular weight of 214.72 g/mol, XLogP of 3.10, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(3-chlorophenyl)-N'-methylcarbamimidothioate is sourced from PubChem (CID 2725135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).