C16H16FN3O4S2 — CID 2725362
[4-[[(4-fluorophenyl)carbamothioylhydrazinylidene]methyl]-2-methoxyphenyl] methanesulfonate (PubChem CID 2725362) has the molecular formula C16H16FN3O4S2 and a molecular weight of 397.45 g/mol. Its IUPAC name is [4-[[(4-fluorophenyl)carbamothioylhydrazinylidene]methyl]-2-methoxyphenyl] methanesulfonate.
| Compound Name | [4-[[(4-fluorophenyl)carbamothioylhydrazinylidene]methyl]-2-methoxyphenyl] methanesulfonate |
|---|---|
| PubChem CID | 2725362 |
| Molecular Formula | C16H16FN3O4S2 |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | [4-[[(4-fluorophenyl)carbamothioylhydrazinylidene]methyl]-2-methoxyphenyl] methanesulfonate |
| SMILES | COc1cc(C=NNC(=S)Nc2ccc(F)cc2)ccc1OS(C)(=O)=O |
| InChI | InChI=1S/C16H16FN3O4S2/c1-23-15-9-11(3-8-14(15)24-26(2,21)22)10-18-20-16(25)19-13-6-4-12(17)5-7-13/h3-10H,1-2H3,(H2,19,20,25) |
| InChIKey | PDCCWTZTFJXSDQ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|