C15H11ClN2O3 — CID 2726279
6-(4-chlorophenyl)-3-cyano-2-oxo-1H-pyridine-4-carboxylic acid ethyl ester (PubChem CID 2726279) has the molecular formula C15H11ClN2O3 and a molecular weight of 302.71 g/mol. Its IUPAC name is ethyl 6-(4-chlorophenyl)-3-cyano-2-oxo-1H-pyridine-4-carboxylate.
| Compound Name | 6-(4-chlorophenyl)-3-cyano-2-oxo-1H-pyridine-4-carboxylic acid ethyl ester |
|---|---|
| PubChem CID | 2726279 |
| Molecular Formula | C15H11ClN2O3 |
| Molecular Weight | 302.71 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | ethyl 6-(4-chlorophenyl)-3-cyano-2-oxo-1H-pyridine-4-carboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)NC(=C1)C2=CC=C(C=C2)Cl)C#N |
| InChI | InChI=1S/C15H11ClN2O3/c1-2-21-15(20)11-7-13(18-14(19)12(11)8-17)9-3-5-10(16)6-4-9/h3-7H,2H2,1H3,(H,18,19) |
| InChIKey | KLJHTDMISIQUDF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | 563 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.71 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |