C17H16FN7O2S — CID 27270226
[4-amino-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]methyl 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate (PubChem CID 27270226) has the molecular formula C17H16FN7O2S and a molecular weight of 401.43 g/mol. Its IUPAC name is [4-amino-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]methyl 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate.
| Compound Name | [4-amino-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]methyl 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 27270226 |
| Molecular Formula | C17H16FN7O2S |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | [4-amino-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]methyl 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate |
| SMILES | C=CCNc1nc(C(=O)OCc2nc(N)nc(Nc3ccc(F)cc3)n2)cs1 |
| InChI | InChI=1S/C17H16FN7O2S/c1-2-7-20-17-22-12(9-28-17)14(26)27-8-13-23-15(19)25-16(24-13)21-11-5-3-10(18)4-6-11/h2-6,9H,1,7-8H2,(H,20,22)(H3,19,21,23,24,25) |
| InChIKey | BWAXOTQZSWJHJE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 127.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|