C17H17N7O2S — CID 7593922
(4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate (PubChem CID 7593922) has the molecular formula C17H17N7O2S and a molecular weight of 383.44 g/mol. Its IUPAC name is (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate.
| Compound Name | (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 7593922 |
| Molecular Formula | C17H17N7O2S |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate |
| SMILES | C=CCNc1nc(C(=O)OCc2nc(N)nc(Nc3ccccc3)n2)cs1 |
| InChI | InChI=1S/C17H17N7O2S/c1-2-8-19-17-21-12(10-27-17)14(25)26-9-13-22-15(18)24-16(23-13)20-11-6-4-3-5-7-11/h2-7,10H,1,8-9H2,(H,19,21)(H3,18,20,22,23,24) |
| InChIKey | ZWYPXKXPWRLDJE-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 127.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|