C16H14N4O3S — CID 16519501
(3-phenyl-1,2,4-oxadiazol-5-yl)methyl 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate (PubChem CID 16519501) has the molecular formula C16H14N4O3S and a molecular weight of 342.38 g/mol. Its IUPAC name is (3-phenyl-1,2,4-oxadiazol-5-yl)methyl 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate.
| Compound Name | (3-phenyl-1,2,4-oxadiazol-5-yl)methyl 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 16519501 |
| Molecular Formula | C16H14N4O3S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | (3-phenyl-1,2,4-oxadiazol-5-yl)methyl 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate |
| SMILES | C=CCNc1nc(C(=O)OCc2nc(-c3ccccc3)no2)cs1 |
| InChI | InChI=1S/C16H14N4O3S/c1-2-8-17-16-18-12(10-24-16)15(21)22-9-13-19-14(20-23-13)11-6-4-3-5-7-11/h2-7,10H,1,8-9H2,(H,17,18) |
| InChIKey | MICQETDUDKAKSA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|