C18H18N4O4S — CID 55500358
[3-(2-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate (PubChem CID 55500358) has the molecular formula C18H18N4O4S and a molecular weight of 386.43 g/mol. Its IUPAC name is [3-(2-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate.
| Compound Name | [3-(2-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 55500358 |
| Molecular Formula | C18H18N4O4S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | [3-(2-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate |
| SMILES | C=CCNc1nc(C(=O)OCc2nc(-c3ccccc3OCC)no2)cs1 |
| InChI | InChI=1S/C18H18N4O4S/c1-3-9-19-18-20-13(11-27-18)17(23)25-10-15-21-16(22-26-15)12-7-5-6-8-14(12)24-4-2/h3,5-8,11H,1,4,9-10H2,2H3,(H,19,20) |
| InChIKey | HWPCLKZUNQHTBA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 99.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|