C15H11F3N4S — CID 2727816
5-(4-aminophenyl)-N-[2-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-amine (PubChem CID 2727816) has the molecular formula C15H11F3N4S and a molecular weight of 336.34 g/mol. Its IUPAC name is 5-(4-aminophenyl)-N-[2-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(4-aminophenyl)-N-[2-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 2727816 |
| Molecular Formula | C15H11F3N4S |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 5-(4-aminophenyl)-N-[2-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-amine |
| SMILES | Nc1ccc(-c2nnc(Nc3ccccc3C(F)(F)F)s2)cc1 |
| InChI | InChI=1S/C15H11F3N4S/c16-15(17,18)11-3-1-2-4-12(11)20-14-22-21-13(23-14)9-5-7-10(19)8-6-9/h1-8H,19H2,(H,20,22) |
| InChIKey | IQXQCTIMZCFJIS-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|