C15H8Cl2O2 — CID 2728252
(5,7-dichloro-1-benzofuran-2-yl)-phenylmethanone (PubChem CID 2728252) has the molecular formula C15H8Cl2O2 and a molecular weight of 291.13 g/mol. Its IUPAC name is (5,7-dichloro-1-benzofuran-2-yl)-phenylmethanone.
| Compound Name | (5,7-dichloro-1-benzofuran-2-yl)-phenylmethanone |
|---|---|
| PubChem CID | 2728252 |
| Molecular Formula | C15H8Cl2O2 |
| Molecular Weight | 291.13 g/mol |
| Exact Mass | 289.99 |
| IUPAC Name | (5,7-dichloro-1-benzofuran-2-yl)-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1cc2cc(Cl)cc(Cl)c2o1 |
| InChI | InChI=1S/C15H8Cl2O2/c16-11-6-10-7-13(19-15(10)12(17)8-11)14(18)9-4-2-1-3-5-9/h1-8H |
| InChIKey | OPILIJYKZWGNIH-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.13 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |