C16H16N2OS — CID 2728424
N-[2-(4-methylphenyl)sulfanyl-3-pyridinyl]cyclopropanecarboxamide (PubChem CID 2728424) has the molecular formula C16H16N2OS and a molecular weight of 284.38 g/mol. Its IUPAC name is N-[2-(4-methylphenyl)sulfanyl-3-pyridinyl]cyclopropanecarboxamide.
| Compound Name | N-[2-(4-methylphenyl)sulfanyl-3-pyridinyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 2728424 |
| Molecular Formula | C16H16N2OS |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | N-[2-(4-methylphenyl)sulfanyl-3-pyridinyl]cyclopropanecarboxamide |
| SMILES | Cc1ccc(Sc2ncccc2NC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C16H16N2OS/c1-11-4-8-13(9-5-11)20-16-14(3-2-10-17-16)18-15(19)12-6-7-12/h2-5,8-10,12H,6-7H2,1H3,(H,18,19) |
| InChIKey | WKLJKKLAPOHJTP-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |