C21H28N4OS — CID 53129863
N-tert-butyl-1-[3-(4-methylphenyl)sulfanylpyrazin-2-yl]piperidine-4-carboxamide (PubChem CID 53129863) has the molecular formula C21H28N4OS and a molecular weight of 384.55 g/mol. Its IUPAC name is N-tert-butyl-1-[3-(4-methylphenyl)sulfanylpyrazin-2-yl]piperidine-4-carboxamide.
| Compound Name | N-tert-butyl-1-[3-(4-methylphenyl)sulfanylpyrazin-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 53129863 |
| Molecular Formula | C21H28N4OS |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | N-tert-butyl-1-[3-(4-methylphenyl)sulfanylpyrazin-2-yl]piperidine-4-carboxamide |
| SMILES | Cc1ccc(Sc2nccnc2N2CCC(C(=O)NC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C21H28N4OS/c1-15-5-7-17(8-6-15)27-20-18(22-11-12-23-20)25-13-9-16(10-14-25)19(26)24-21(2,3)4/h5-8,11-12,16H,9-10,13-14H2,1-4H3,(H,24,26) |
| InChIKey | QTPHFFUKHZORTH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |