C12H14F6N4O2 — CID 2729323
butyl N-[1,1,1,3,3,3-hexafluoro-2-(pyrimidin-2-ylamino)propan-2-yl]carbamate (PubChem CID 2729323) has the molecular formula C12H14F6N4O2 and a molecular weight of 360.26 g/mol. Its IUPAC name is butyl N-[1,1,1,3,3,3-hexafluoro-2-(pyrimidin-2-ylamino)propan-2-yl]carbamate.
| Compound Name | butyl N-[1,1,1,3,3,3-hexafluoro-2-(pyrimidin-2-ylamino)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 2729323 |
| Molecular Formula | C12H14F6N4O2 |
| Molecular Weight | 360.26 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | butyl N-[1,1,1,3,3,3-hexafluoro-2-(pyrimidin-2-ylamino)propan-2-yl]carbamate |
| SMILES | CCCCOC(=O)NC(Nc1ncccn1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H14F6N4O2/c1-2-3-7-24-9(23)22-10(11(13,14)15,12(16,17)18)21-8-19-5-4-6-20-8/h4-6H,2-3,7H2,1H3,(H,22,23)(H,19,20,21) |
| InChIKey | VMFKJVAHWHVNJD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.26 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|