C11H16N2S — CID 2731044
3-(3,4-dimethylphenyl)-1,1-dimethylthiourea (PubChem CID 2731044) has the molecular formula C11H16N2S and a molecular weight of 208.33 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-1,1-dimethylthiourea.
| Compound Name | 3-(3,4-dimethylphenyl)-1,1-dimethylthiourea |
|---|---|
| PubChem CID | 2731044 |
| Molecular Formula | C11H16N2S |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-1,1-dimethylthiourea |
| SMILES | Cc1ccc(NC(=S)N(C)C)cc1C |
| InChI | InChI=1S/C11H16N2S/c1-8-5-6-10(7-9(8)2)12-11(14)13(3)4/h5-7H,1-4H3,(H,12,14) |
| InChIKey | WFIGMVFPEZTTAO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|