About N-(4-fluorophenyl)-4,5-dihydro-1H-imidazol-2-amine
N-(4-fluorophenyl)-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 2731293) has the molecular formula C9H10FN3
and a molecular weight of 179.20 g/mol. Its IUPAC name is N-(4-fluorophenyl)-4,5-dihydro-1H-imidazol-2-amine.
Molecular Properties
| Compound Name | N-(4-fluorophenyl)-4,5-dihydro-1H-imidazol-2-amine |
| PubChem CID | 2731293 |
| Molecular Formula | C9H10FN3 |
| Molecular Weight | 179.20 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | N-(4-fluorophenyl)-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | Fc1ccc(NC2=NCCN2)cc1 |
| InChI | InChI=1S/C9H10FN3/c10-7-1-3-8(4-2-7)13-9-11-5-6-12-9/h1-4H,5-6H2,(H2,11,12,13) |
| InChIKey | IOUVWAKVDFTALH-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.20 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4-fluorophenyl)-4,5-dihydro-1H-imidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-fluorophenyl)-4,5-dihydro-1H-imidazol-2-amine?
The IUPAC name of N-(4-fluorophenyl)-4,5-dihydro-1H-imidazol-2-amine (CID 2731293) is N-(4-fluorophenyl)-4,5-dihydro-1H-imidazol-2-amine.
What is the SMILES notation for N-(4-fluorophenyl)-4,5-dihydro-1H-imidazol-2-amine?
The canonical SMILES for N-(4-fluorophenyl)-4,5-dihydro-1H-imidazol-2-amine is Fc1ccc(NC2=NCCN2)cc1.
What is the InChIKey of N-(4-fluorophenyl)-4,5-dihydro-1H-imidazol-2-amine?
The InChIKey is IOUVWAKVDFTALH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FN3/c10-7-1-3-8(4-2-7)13-9-11-5-6-12-9/h1-4H,5-6H2,(H2,11,12,13).
What are the key properties of N-(4-fluorophenyl)-4,5-dihydro-1H-imidazol-2-amine?
N-(4-fluorophenyl)-4,5-dihydro-1H-imidazol-2-amine has a molecular weight of 179.20 g/mol, XLogP of 1.20, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-fluorophenyl)-4,5-dihydro-1H-imidazol-2-amine is sourced from PubChem (CID 2731293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).