About prop-2-ynyl 2-(5-chloro-2-prop-2-ynoxycarbonylanilino)-5-nitrobenzoate
prop-2-ynyl 2-(5-chloro-2-prop-2-ynoxycarbonylanilino)-5-nitrobenzoate (PubChem CID 2731795) has the molecular formula C20H13ClN2O6
and a molecular weight of 412.79 g/mol. Its IUPAC name is prop-2-ynyl 2-(5-chloro-2-prop-2-ynoxycarbonylanilino)-5-nitrobenzoate.
Molecular Properties
| Compound Name | prop-2-ynyl 2-(5-chloro-2-prop-2-ynoxycarbonylanilino)-5-nitrobenzoate |
| PubChem CID | 2731795 |
| Molecular Formula | C20H13ClN2O6 |
| Molecular Weight | 412.79 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | prop-2-ynyl 2-(5-chloro-2-prop-2-ynoxycarbonylanilino)-5-nitrobenzoate |
| SMILES | C#CCOC(=O)c1ccc(Cl)cc1Nc1ccc([N+](=O)[O-])cc1C(=O)OCC#C |
| InChI | InChI=1S/C20H13ClN2O6/c1-3-9-28-19(24)15-7-5-13(21)11-18(15)22-17-8-6-14(23(26)27)12-16(17)20(25)29-10-4-2/h1-2,5-8,11-12,22H,9-10H2 |
| InChIKey | IJVZWCQKZKTXSG-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.79 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze prop-2-ynyl 2-(5-chloro-2-prop-2-ynoxycarbonylanilino)-5-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-ynyl 2-(5-chloro-2-prop-2-ynoxycarbonylanilino)-5-nitrobenzoate?
The IUPAC name of prop-2-ynyl 2-(5-chloro-2-prop-2-ynoxycarbonylanilino)-5-nitrobenzoate (CID 2731795) is prop-2-ynyl 2-(5-chloro-2-prop-2-ynoxycarbonylanilino)-5-nitrobenzoate.
What is the SMILES notation for prop-2-ynyl 2-(5-chloro-2-prop-2-ynoxycarbonylanilino)-5-nitrobenzoate?
The canonical SMILES for prop-2-ynyl 2-(5-chloro-2-prop-2-ynoxycarbonylanilino)-5-nitrobenzoate is C#CCOC(=O)c1ccc(Cl)cc1Nc1ccc([N+](=O)[O-])cc1C(=O)OCC#C.
What is the InChIKey of prop-2-ynyl 2-(5-chloro-2-prop-2-ynoxycarbonylanilino)-5-nitrobenzoate?
The InChIKey is IJVZWCQKZKTXSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13ClN2O6/c1-3-9-28-19(24)15-7-5-13(21)11-18(15)22-17-8-6-14(23(26)27)12-16(17)20(25)29-10-4-2/h1-2,5-8,11-12,22H,9-10H2.
What are the key properties of prop-2-ynyl 2-(5-chloro-2-prop-2-ynoxycarbonylanilino)-5-nitrobenzoate?
prop-2-ynyl 2-(5-chloro-2-prop-2-ynoxycarbonylanilino)-5-nitrobenzoate has a molecular weight of 412.79 g/mol, XLogP of 3.57, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-ynyl 2-(5-chloro-2-prop-2-ynoxycarbonylanilino)-5-nitrobenzoate is sourced from PubChem (CID 2731795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).