C26H26N2O6S — CID 27340022
diethyl 5-[[(1R)-1-benzamido-2-oxo-2-phenylethyl]amino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 27340022) has the molecular formula C26H26N2O6S and a molecular weight of 494.57 g/mol. Its IUPAC name is diethyl 5-[[(1R)-1-benzamido-2-oxo-2-phenylethyl]amino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-[[(1R)-1-benzamido-2-oxo-2-phenylethyl]amino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 27340022 |
| Molecular Formula | C26H26N2O6S |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | diethyl 5-[[(1R)-1-benzamido-2-oxo-2-phenylethyl]amino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(N[C@@H](NC(=O)c2ccccc2)C(=O)c2ccccc2)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C26H26N2O6S/c1-4-33-25(31)19-16(3)21(26(32)34-5-2)35-24(19)28-22(20(29)17-12-8-6-9-13-17)27-23(30)18-14-10-7-11-15-18/h6-15,22,28H,4-5H2,1-3H3,(H,27,30)/t22-/m1/s1 |
| InChIKey | DISWOFWQAZHMGU-JOCHJYFZSA-N |
| XLogP | 4.46 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|