C5H8BNO3 — CID 2734346
(3,5-dimethyl-1,2-oxazol-4-yl)boronic acid (PubChem CID 2734346) has the molecular formula C5H8BNO3 and a molecular weight of 140.94 g/mol. Its IUPAC name is (3,5-dimethyl-1,2-oxazol-4-yl)boronic acid.
| Compound Name | (3,5-dimethyl-1,2-oxazol-4-yl)boronic acid |
|---|---|
| PubChem CID | 2734346 |
| Molecular Formula | C5H8BNO3 |
| Molecular Weight | 140.94 g/mol |
| Exact Mass | 141.06 |
| IUPAC Name | (3,5-dimethyl-1,2-oxazol-4-yl)boronic acid |
| SMILES | Cc1noc(C)c1B(O)O |
| InChI | InChI=1S/C5H8BNO3/c1-3-5(6(8)9)4(2)10-7-3/h8-9H,1-2H3 |
| InChIKey | DIIFZCPZIRQDIJ-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.94 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|