About (1S)-1-phenylpropan-1-ol
(1S)-1-phenylpropan-1-ol (PubChem CID 2734864) has the molecular formula C9H12O
and a molecular weight of 136.19 g/mol. Its IUPAC name is (1S)-1-phenylpropan-1-ol.
Molecular Properties
| Compound Name | (1S)-1-phenylpropan-1-ol |
| PubChem CID | 2734864 |
| Molecular Formula | C9H12O |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.09 |
| IUPAC Name | (1S)-1-phenylpropan-1-ol |
| SMILES | CC[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C9H12O/c1-2-9(10)8-6-4-3-5-7-8/h3-7,9-10H,2H2,1H3/t9-/m0/s1 |
| InChIKey | DYUQAZSOFZSPHD-VIFPVBQESA-N |
| XLogP | 2.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.19 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1S)-1-phenylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-phenylpropan-1-ol?
The IUPAC name of (1S)-1-phenylpropan-1-ol (CID 2734864) is (1S)-1-phenylpropan-1-ol.
What is the SMILES notation for (1S)-1-phenylpropan-1-ol?
The canonical SMILES for (1S)-1-phenylpropan-1-ol is CC[C@H](O)c1ccccc1.
What is the InChIKey of (1S)-1-phenylpropan-1-ol?
The InChIKey is DYUQAZSOFZSPHD-VIFPVBQESA-N. The full InChI is InChI=1S/C9H12O/c1-2-9(10)8-6-4-3-5-7-8/h3-7,9-10H,2H2,1H3/t9-/m0/s1.
What are the key properties of (1S)-1-phenylpropan-1-ol?
(1S)-1-phenylpropan-1-ol has a molecular weight of 136.19 g/mol, XLogP of 2.13, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-phenylpropan-1-ol is sourced from PubChem (CID 2734864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).