C23H17N3O5 — CID 27370701
1-benzyl-6-oxo-N'-(4-oxochromene-2-carbonyl)pyridine-3-carbohydrazide (PubChem CID 27370701) has the molecular formula C23H17N3O5 and a molecular weight of 415.41 g/mol. Its IUPAC name is 1-benzyl-6-oxo-N'-(4-oxochromene-2-carbonyl)pyridine-3-carbohydrazide.
| Compound Name | 1-benzyl-6-oxo-N'-(4-oxochromene-2-carbonyl)pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 27370701 |
| Molecular Formula | C23H17N3O5 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 1-benzyl-6-oxo-N'-(4-oxochromene-2-carbonyl)pyridine-3-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cc(=O)c2ccccc2o1)c1ccc(=O)n(Cc2ccccc2)c1 |
| InChI | InChI=1S/C23H17N3O5/c27-18-12-20(31-19-9-5-4-8-17(18)19)23(30)25-24-22(29)16-10-11-21(28)26(14-16)13-15-6-2-1-3-7-15/h1-12,14H,13H2,(H,24,29)(H,25,30) |
| InChIKey | DOPUMDJSIMDKDR-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 110.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|