C20H16ClN3O3 — CID 27370713
1-benzyl-N'-(4-chlorobenzoyl)-6-oxopyridine-3-carbohydrazide (PubChem CID 27370713) has the molecular formula C20H16ClN3O3 and a molecular weight of 381.82 g/mol. Its IUPAC name is 1-benzyl-N'-(4-chlorobenzoyl)-6-oxopyridine-3-carbohydrazide.
| Compound Name | 1-benzyl-N'-(4-chlorobenzoyl)-6-oxopyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 27370713 |
| Molecular Formula | C20H16ClN3O3 |
| Molecular Weight | 381.82 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 1-benzyl-N'-(4-chlorobenzoyl)-6-oxopyridine-3-carbohydrazide |
| SMILES | O=C(NNC(=O)c1ccc(=O)n(Cc2ccccc2)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H16ClN3O3/c21-17-9-6-15(7-10-17)19(26)22-23-20(27)16-8-11-18(25)24(13-16)12-14-4-2-1-3-5-14/h1-11,13H,12H2,(H,22,26)(H,23,27) |
| InChIKey | QLZOSIKQAAMVJU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.82 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|