C21H18ClN3O3S — CID 27370758
1-[(4-chlorophenyl)methyl]-N'-(2-methylsulfanylbenzoyl)-6-oxopyridine-3-carbohydrazide (PubChem CID 27370758) has the molecular formula C21H18ClN3O3S and a molecular weight of 427.91 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-N'-(2-methylsulfanylbenzoyl)-6-oxopyridine-3-carbohydrazide.
| Compound Name | 1-[(4-chlorophenyl)methyl]-N'-(2-methylsulfanylbenzoyl)-6-oxopyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 27370758 |
| Molecular Formula | C21H18ClN3O3S |
| Molecular Weight | 427.91 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-N'-(2-methylsulfanylbenzoyl)-6-oxopyridine-3-carbohydrazide |
| SMILES | CSc1ccccc1C(=O)NNC(=O)c1ccc(=O)n(Cc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C21H18ClN3O3S/c1-29-18-5-3-2-4-17(18)21(28)24-23-20(27)15-8-11-19(26)25(13-15)12-14-6-9-16(22)10-7-14/h2-11,13H,12H2,1H3,(H,23,27)(H,24,28) |
| InChIKey | DTYVTUWDLWALJV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.91 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|