C12H15N7O2 — CID 2739071
1-propan-2-yl-3-[(3-pyridin-2-yl-1H-1,2,4-triazole-5-carbonyl)amino]urea (PubChem CID 2739071) has the molecular formula C12H15N7O2 and a molecular weight of 289.30 g/mol. Its IUPAC name is 1-propan-2-yl-3-[(3-pyridin-2-yl-1H-1,2,4-triazole-5-carbonyl)amino]urea.
| Compound Name | 1-propan-2-yl-3-[(3-pyridin-2-yl-1H-1,2,4-triazole-5-carbonyl)amino]urea |
|---|---|
| PubChem CID | 2739071 |
| Molecular Formula | C12H15N7O2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 1-propan-2-yl-3-[(3-pyridin-2-yl-1H-1,2,4-triazole-5-carbonyl)amino]urea |
| SMILES | CC(C)NC(=O)NNC(=O)c1nc(-c2ccccn2)n[nH]1 |
| InChI | InChI=1S/C12H15N7O2/c1-7(2)14-12(21)19-18-11(20)10-15-9(16-17-10)8-5-3-4-6-13-8/h3-7H,1-2H3,(H,18,20)(H2,14,19,21)(H,15,16,17) |
| InChIKey | FPMBWWIXRORQHE-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 124.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|