C28H25N3O — CID 166440950
5-[(E)-1,2-diphenylethenyl]-N-propan-2-yl-6-pyridin-2-ylpyridine-2-carboxamide (PubChem CID 166440950) has the molecular formula C28H25N3O and a molecular weight of 419.53 g/mol. Its IUPAC name is 5-[(E)-1,2-diphenylethenyl]-N-propan-2-yl-6-pyridin-2-ylpyridine-2-carboxamide.
| Compound Name | 5-[(E)-1,2-diphenylethenyl]-N-propan-2-yl-6-pyridin-2-ylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 166440950 |
| Molecular Formula | C28H25N3O |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 5-[(E)-1,2-diphenylethenyl]-N-propan-2-yl-6-pyridin-2-ylpyridine-2-carboxamide |
| SMILES | CC(C)NC(=O)c1ccc(/C(=C/c2ccccc2)c2ccccc2)c(-c2ccccn2)n1 |
| InChI | InChI=1S/C28H25N3O/c1-20(2)30-28(32)26-17-16-23(27(31-26)25-15-9-10-18-29-25)24(22-13-7-4-8-14-22)19-21-11-5-3-6-12-21/h3-20H,1-2H3,(H,30,32)/b24-19+ |
| InChIKey | JFLHNKMZRMCZRT-LYBHJNIJSA-N |
| XLogP | 5.87 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|