C13H9FO3S — CID 2739654
methyl 8-fluoro-4H-thieno[3,2-c]chromene-2-carboxylate (PubChem CID 2739654) has the molecular formula C13H9FO3S and a molecular weight of 264.28 g/mol. Its IUPAC name is methyl 8-fluoro-4H-thieno[3,2-c]chromene-2-carboxylate.
| Compound Name | methyl 8-fluoro-4H-thieno[3,2-c]chromene-2-carboxylate |
|---|---|
| PubChem CID | 2739654 |
| Molecular Formula | C13H9FO3S |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | methyl 8-fluoro-4H-thieno[3,2-c]chromene-2-carboxylate |
| SMILES | COC(=O)c1cc2c(s1)-c1cc(F)ccc1OC2 |
| InChI | InChI=1S/C13H9FO3S/c1-16-13(15)11-4-7-6-17-10-3-2-8(14)5-9(10)12(7)18-11/h2-5H,6H2,1H3 |
| InChIKey | WKUSYBGGANBUCI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |