C12H6ClFO3S — CID 71059356
8-chloro-6-fluoro-4H-thieno[3,2-c]chromene-2-carboxylic acid (PubChem CID 71059356) has the molecular formula C12H6ClFO3S and a molecular weight of 284.69 g/mol. Its IUPAC name is 8-chloro-6-fluoro-4H-thieno[3,2-c]chromene-2-carboxylic acid.
| Compound Name | 8-chloro-6-fluoro-4H-thieno[3,2-c]chromene-2-carboxylic acid |
|---|---|
| PubChem CID | 71059356 |
| Molecular Formula | C12H6ClFO3S |
| Molecular Weight | 284.69 g/mol |
| Exact Mass | 283.97 |
| IUPAC Name | 8-chloro-6-fluoro-4H-thieno[3,2-c]chromene-2-carboxylic acid |
| SMILES | O=C(O)c1cc2c(s1)-c1cc(Cl)cc(F)c1OC2 |
| InChI | InChI=1S/C12H6ClFO3S/c13-6-2-7-10(8(14)3-6)17-4-5-1-9(12(15)16)18-11(5)7/h1-3H,4H2,(H,15,16) |
| InChIKey | UNYHIZTXAVQMOM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.69 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |