C14H7F6N3O4S — CID 2740097
[[amino-[3,5-bis(trifluoromethyl)phenyl]methylidene]amino] 5-nitrothiophene-3-carboxylate (PubChem CID 2740097) has the molecular formula C14H7F6N3O4S and a molecular weight of 427.28 g/mol. Its IUPAC name is [[amino-[3,5-bis(trifluoromethyl)phenyl]methylidene]amino] 5-nitrothiophene-3-carboxylate.
| Compound Name | [[amino-[3,5-bis(trifluoromethyl)phenyl]methylidene]amino] 5-nitrothiophene-3-carboxylate |
|---|---|
| PubChem CID | 2740097 |
| Molecular Formula | C14H7F6N3O4S |
| Molecular Weight | 427.28 g/mol |
| Exact Mass | 427.01 |
| IUPAC Name | [[amino-[3,5-bis(trifluoromethyl)phenyl]methylidene]amino] 5-nitrothiophene-3-carboxylate |
| SMILES | NC(=NOC(=O)c1csc([N+](=O)[O-])c1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H7F6N3O4S/c15-13(16,17)8-1-6(2-9(4-8)14(18,19)20)11(21)22-27-12(24)7-3-10(23(25)26)28-5-7/h1-5H,(H2,21,22) |
| InChIKey | WVEBCSOMOQRYCT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.28 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|