C15H8ClF6NO2 — CID 2740405
N-[4-chloro-2-(trifluoromethoxy)phenyl]-3-(trifluoromethyl)benzamide (PubChem CID 2740405) has the molecular formula C15H8ClF6NO2 and a molecular weight of 383.68 g/mol. Its IUPAC name is N-[4-chloro-2-(trifluoromethoxy)phenyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[4-chloro-2-(trifluoromethoxy)phenyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 2740405 |
| Molecular Formula | C15H8ClF6NO2 |
| Molecular Weight | 383.68 g/mol |
| Exact Mass | 383.01 |
| IUPAC Name | N-[4-chloro-2-(trifluoromethoxy)phenyl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1ccc(Cl)cc1OC(F)(F)F)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H8ClF6NO2/c16-10-4-5-11(12(7-10)25-15(20,21)22)23-13(24)8-2-1-3-9(6-8)14(17,18)19/h1-7H,(H,23,24) |
| InChIKey | GOPAJWSTMQCMOT-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.68 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |