C18H10F9NO2 — CID 2740466
[(1,1,1-trifluoro-3-phenylpropan-2-ylidene)amino] 3,5-bis(trifluoromethyl)benzoate (PubChem CID 2740466) has the molecular formula C18H10F9NO2 and a molecular weight of 443.27 g/mol. Its IUPAC name is [(1,1,1-trifluoro-3-phenylpropan-2-ylidene)amino] 3,5-bis(trifluoromethyl)benzoate.
| Compound Name | [(1,1,1-trifluoro-3-phenylpropan-2-ylidene)amino] 3,5-bis(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 2740466 |
| Molecular Formula | C18H10F9NO2 |
| Molecular Weight | 443.27 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | [(1,1,1-trifluoro-3-phenylpropan-2-ylidene)amino] 3,5-bis(trifluoromethyl)benzoate |
| SMILES | O=C(ON=C(Cc1ccccc1)C(F)(F)F)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H10F9NO2/c19-16(20,21)12-7-11(8-13(9-12)17(22,23)24)15(29)30-28-14(18(25,26)27)6-10-4-2-1-3-5-10/h1-5,7-9H,6H2 |
| InChIKey | CQPGCUFKSMXHIQ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.27 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|