C18H10F8N2O2 — CID 2804137
[[1-amino-3-[3,5-bis(trifluoromethyl)phenyl]prop-2-enylidene]amino] 2,6-difluorobenzoate (PubChem CID 2804137) has the molecular formula C18H10F8N2O2 and a molecular weight of 438.27 g/mol. Its IUPAC name is [[1-amino-3-[3,5-bis(trifluoromethyl)phenyl]prop-2-enylidene]amino] 2,6-difluorobenzoate.
| Compound Name | [[1-amino-3-[3,5-bis(trifluoromethyl)phenyl]prop-2-enylidene]amino] 2,6-difluorobenzoate |
|---|---|
| PubChem CID | 2804137 |
| Molecular Formula | C18H10F8N2O2 |
| Molecular Weight | 438.27 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | [[1-amino-3-[3,5-bis(trifluoromethyl)phenyl]prop-2-enylidene]amino] 2,6-difluorobenzoate |
| SMILES | NC(C=Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)=NOC(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C18H10F8N2O2/c19-12-2-1-3-13(20)15(12)16(29)30-28-14(27)5-4-9-6-10(17(21,22)23)8-11(7-9)18(24,25)26/h1-8H,(H2,27,28) |
| InChIKey | WUFYRKZPKXRHCD-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.27 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|