C17H12FN3O5S2 — CID 27424721
2-[2-[[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-1,3-thiazol-4-yl]acetic acid (PubChem CID 27424721) has the molecular formula C17H12FN3O5S2 and a molecular weight of 421.43 g/mol. Its IUPAC name is 2-[2-[[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-[[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 27424721 |
| Molecular Formula | C17H12FN3O5S2 |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.02 |
| IUPAC Name | 2-[2-[[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-1,3-thiazol-4-yl]acetic acid |
| SMILES | O=C(O)Cc1csc(NC(=O)CN2C(=O)S/C(=C\c3ccccc3F)C2=O)n1 |
| InChI | InChI=1S/C17H12FN3O5S2/c18-11-4-2-1-3-9(11)5-12-15(25)21(17(26)28-12)7-13(22)20-16-19-10(8-27-16)6-14(23)24/h1-5,8H,6-7H2,(H,23,24)(H,19,20,22)/b12-5- |
| InChIKey | SWHXMRSGQXUNPN-XGICHPGQSA-N |
| XLogP | 2.58 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|