C15H16Cl2N2O2S — CID 2743187
3,4-dichloro-N'-(4-propan-2-ylphenyl)benzenesulfonohydrazide (PubChem CID 2743187) has the molecular formula C15H16Cl2N2O2S and a molecular weight of 359.28 g/mol. Its IUPAC name is 3,4-dichloro-N'-(4-propan-2-ylphenyl)benzenesulfonohydrazide.
| Compound Name | 3,4-dichloro-N'-(4-propan-2-ylphenyl)benzenesulfonohydrazide |
|---|---|
| PubChem CID | 2743187 |
| Molecular Formula | C15H16Cl2N2O2S |
| Molecular Weight | 359.28 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | 3,4-dichloro-N'-(4-propan-2-ylphenyl)benzenesulfonohydrazide |
| SMILES | CC(C)c1ccc(NNS(=O)(=O)c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C15H16Cl2N2O2S/c1-10(2)11-3-5-12(6-4-11)18-19-22(20,21)13-7-8-14(16)15(17)9-13/h3-10,18-19H,1-2H3 |
| InChIKey | ZUHUUBABKNXABT-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.28 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|