C18H15N3O5S — CID 27436681
(5Z)-2-(2-hydroxy-4-methylphenyl)imino-5-[(2-hydroxy-5-nitrophenyl)methylidene]-3-methyl-1,3-thiazolidin-4-one (PubChem CID 27436681) has the molecular formula C18H15N3O5S and a molecular weight of 385.40 g/mol. Its IUPAC name is (5Z)-2-(2-hydroxy-4-methylphenyl)imino-5-[(2-hydroxy-5-nitrophenyl)methylidene]-3-methyl-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(2-hydroxy-4-methylphenyl)imino-5-[(2-hydroxy-5-nitrophenyl)methylidene]-3-methyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 27436681 |
| Molecular Formula | C18H15N3O5S |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | (5Z)-2-(2-hydroxy-4-methylphenyl)imino-5-[(2-hydroxy-5-nitrophenyl)methylidene]-3-methyl-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(/N=C2/S/C(=C\c3cc([N+](=O)[O-])ccc3O)C(=O)N2C)c(O)c1 |
| InChI | InChI=1S/C18H15N3O5S/c1-10-3-5-13(15(23)7-10)19-18-20(2)17(24)16(27-18)9-11-8-12(21(25)26)4-6-14(11)22/h3-9,22-23H,1-2H3/b16-9-,19-18+ |
| InChIKey | WSBAKLABHSLKTK-JQHIFNHESA-N |
| XLogP | 3.55 |
| TPSA | 116.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|