C17H11Cl3N4O4S — CID 2743730
3-[(4-chlorophenyl)sulfonylmethyl]-N-[(2,6-dichlorophenyl)methylideneamino]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 2743730) has the molecular formula C17H11Cl3N4O4S and a molecular weight of 473.73 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)sulfonylmethyl]-N-[(2,6-dichlorophenyl)methylideneamino]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-[(4-chlorophenyl)sulfonylmethyl]-N-[(2,6-dichlorophenyl)methylideneamino]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 2743730 |
| Molecular Formula | C17H11Cl3N4O4S |
| Molecular Weight | 473.73 g/mol |
| Exact Mass | 471.96 |
| IUPAC Name | 3-[(4-chlorophenyl)sulfonylmethyl]-N-[(2,6-dichlorophenyl)methylideneamino]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | O=C(NN=Cc1c(Cl)cccc1Cl)c1nc(CS(=O)(=O)c2ccc(Cl)cc2)no1 |
| InChI | InChI=1S/C17H11Cl3N4O4S/c18-10-4-6-11(7-5-10)29(26,27)9-15-22-17(28-24-15)16(25)23-21-8-12-13(19)2-1-3-14(12)20/h1-8H,9H2,(H,23,25) |
| InChIKey | YWOIYOSCSACAGA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 114.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.73 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|