About S-pyridin-2-yl 4-(2,4-dichlorophenoxy)-3-nitrobenzenecarbothioate
S-pyridin-2-yl 4-(2,4-dichlorophenoxy)-3-nitrobenzenecarbothioate (PubChem CID 2743821) has the molecular formula C18H10Cl2N2O4S
and a molecular weight of 421.26 g/mol. Its IUPAC name is S-pyridin-2-yl 4-(2,4-dichlorophenoxy)-3-nitrobenzenecarbothioate.
Molecular Properties
| Compound Name | S-pyridin-2-yl 4-(2,4-dichlorophenoxy)-3-nitrobenzenecarbothioate |
| PubChem CID | 2743821 |
| Molecular Formula | C18H10Cl2N2O4S |
| Molecular Weight | 421.26 g/mol |
| Exact Mass | 419.97 |
| IUPAC Name | S-pyridin-2-yl 4-(2,4-dichlorophenoxy)-3-nitrobenzenecarbothioate |
| SMILES | O=C(Sc1ccccn1)c1ccc(Oc2ccc(Cl)cc2Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H10Cl2N2O4S/c19-12-5-7-15(13(20)10-12)26-16-6-4-11(9-14(16)22(24)25)18(23)27-17-3-1-2-8-21-17/h1-10H |
| InChIKey | BBRZBINNRRTOGB-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.26 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-pyridin-2-yl 4-(2,4-dichlorophenoxy)-3-nitrobenzenecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-pyridin-2-yl 4-(2,4-dichlorophenoxy)-3-nitrobenzenecarbothioate?
The IUPAC name of S-pyridin-2-yl 4-(2,4-dichlorophenoxy)-3-nitrobenzenecarbothioate (CID 2743821) is S-pyridin-2-yl 4-(2,4-dichlorophenoxy)-3-nitrobenzenecarbothioate.
What is the SMILES notation for S-pyridin-2-yl 4-(2,4-dichlorophenoxy)-3-nitrobenzenecarbothioate?
The canonical SMILES for S-pyridin-2-yl 4-(2,4-dichlorophenoxy)-3-nitrobenzenecarbothioate is O=C(Sc1ccccn1)c1ccc(Oc2ccc(Cl)cc2Cl)c([N+](=O)[O-])c1.
What is the InChIKey of S-pyridin-2-yl 4-(2,4-dichlorophenoxy)-3-nitrobenzenecarbothioate?
The InChIKey is BBRZBINNRRTOGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H10Cl2N2O4S/c19-12-5-7-15(13(20)10-12)26-16-6-4-11(9-14(16)22(24)25)18(23)27-17-3-1-2-8-21-17/h1-10H.
What are the key properties of S-pyridin-2-yl 4-(2,4-dichlorophenoxy)-3-nitrobenzenecarbothioate?
S-pyridin-2-yl 4-(2,4-dichlorophenoxy)-3-nitrobenzenecarbothioate has a molecular weight of 421.26 g/mol, XLogP of 6.02, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for S-pyridin-2-yl 4-(2,4-dichlorophenoxy)-3-nitrobenzenecarbothioate is sourced from PubChem (CID 2743821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).