C14H11ClN6O2S — CID 2744076
2-chloro-N'-[2-(5-thiophen-2-yltetrazol-2-yl)acetyl]benzohydrazide (PubChem CID 2744076) has the molecular formula C14H11ClN6O2S and a molecular weight of 362.80 g/mol. Its IUPAC name is 2-chloro-N'-[2-(5-thiophen-2-yltetrazol-2-yl)acetyl]benzohydrazide.
| Compound Name | 2-chloro-N'-[2-(5-thiophen-2-yltetrazol-2-yl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 2744076 |
| Molecular Formula | C14H11ClN6O2S |
| Molecular Weight | 362.80 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | 2-chloro-N'-[2-(5-thiophen-2-yltetrazol-2-yl)acetyl]benzohydrazide |
| SMILES | O=C(Cn1nnc(-c2cccs2)n1)NNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C14H11ClN6O2S/c15-10-5-2-1-4-9(10)14(23)18-16-12(22)8-21-19-13(17-20-21)11-6-3-7-24-11/h1-7H,8H2,(H,16,22)(H,18,23) |
| InChIKey | FXFQHDNHPAYDQV-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.80 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|