C20H16N4OS — CID 2745608
N-(benzylideneamino)-4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-1,3-thiazol-2-amine (PubChem CID 2745608) has the molecular formula C20H16N4OS and a molecular weight of 360.44 g/mol. Its IUPAC name is N-(benzylideneamino)-4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-1,3-thiazol-2-amine.
| Compound Name | N-(benzylideneamino)-4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 2745608 |
| Molecular Formula | C20H16N4OS |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | N-(benzylideneamino)-4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-1,3-thiazol-2-amine |
| SMILES | Cc1onc(-c2ccccc2)c1-c1csc(NN=Cc2ccccc2)n1 |
| InChI | InChI=1S/C20H16N4OS/c1-14-18(19(24-25-14)16-10-6-3-7-11-16)17-13-26-20(22-17)23-21-12-15-8-4-2-5-9-15/h2-13H,1H3,(H,22,23) |
| InChIKey | YEJJCFSYEVSIAA-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 63.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|