C21H27N3O6S — CID 27505970
N'-[(2R)-2-(furan-2-yl)-2-(4-methylphenyl)sulfonylethyl]-N-(2-morpholin-4-ylethyl)oxamide (PubChem CID 27505970) has the molecular formula C21H27N3O6S and a molecular weight of 449.53 g/mol. Its IUPAC name is N'-[(2R)-2-(furan-2-yl)-2-(4-methylphenyl)sulfonylethyl]-N-(2-morpholin-4-ylethyl)oxamide.
| Compound Name | N'-[(2R)-2-(furan-2-yl)-2-(4-methylphenyl)sulfonylethyl]-N-(2-morpholin-4-ylethyl)oxamide |
|---|---|
| PubChem CID | 27505970 |
| Molecular Formula | C21H27N3O6S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | N'-[(2R)-2-(furan-2-yl)-2-(4-methylphenyl)sulfonylethyl]-N-(2-morpholin-4-ylethyl)oxamide |
| SMILES | Cc1ccc(S(=O)(=O)[C@H](CNC(=O)C(=O)NCCN2CCOCC2)c2ccco2)cc1 |
| InChI | InChI=1S/C21H27N3O6S/c1-16-4-6-17(7-5-16)31(27,28)19(18-3-2-12-30-18)15-23-21(26)20(25)22-8-9-24-10-13-29-14-11-24/h2-7,12,19H,8-11,13-15H2,1H3,(H,22,25)(H,23,26)/t19-/m1/s1 |
| InChIKey | QGURQVUFIJTEJL-LJQANCHMSA-N |
| XLogP | 0.67 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|