C20H25N3O6S — CID 92693498
N'-[(2S)-2-(benzenesulfonyl)-2-(furan-2-yl)ethyl]-N-(2-morpholin-4-ylethyl)oxamide (PubChem CID 92693498) has the molecular formula C20H25N3O6S and a molecular weight of 435.50 g/mol. Its IUPAC name is N'-[(2S)-2-(benzenesulfonyl)-2-(furan-2-yl)ethyl]-N-(2-morpholin-4-ylethyl)oxamide.
| Compound Name | N'-[(2S)-2-(benzenesulfonyl)-2-(furan-2-yl)ethyl]-N-(2-morpholin-4-ylethyl)oxamide |
|---|---|
| PubChem CID | 92693498 |
| Molecular Formula | C20H25N3O6S |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | N'-[(2S)-2-(benzenesulfonyl)-2-(furan-2-yl)ethyl]-N-(2-morpholin-4-ylethyl)oxamide |
| SMILES | O=C(NCCN1CCOCC1)C(=O)NC[C@@H](c1ccco1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H25N3O6S/c24-19(21-8-9-23-10-13-28-14-11-23)20(25)22-15-18(17-7-4-12-29-17)30(26,27)16-5-2-1-3-6-16/h1-7,12,18H,8-11,13-15H2,(H,21,24)(H,22,25)/t18-/m0/s1 |
| InChIKey | KZFHSQIPTZNXMV-SFHVURJKSA-N |
| XLogP | 0.36 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|