C18H19N5O4 — CID 27532866
N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-(2-oxoquinoxalin-1-yl)acetamide (PubChem CID 27532866) has the molecular formula C18H19N5O4 and a molecular weight of 369.38 g/mol. Its IUPAC name is N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-(2-oxoquinoxalin-1-yl)acetamide.
| Compound Name | N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-(2-oxoquinoxalin-1-yl)acetamide |
|---|---|
| PubChem CID | 27532866 |
| Molecular Formula | C18H19N5O4 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-(2-oxoquinoxalin-1-yl)acetamide |
| SMILES | O=C(Cn1c(=O)cnc2ccccc21)NN1C(=O)NC2(CCCCC2)C1=O |
| InChI | InChI=1S/C18H19N5O4/c24-14(11-22-13-7-3-2-6-12(13)19-10-15(22)25)21-23-16(26)18(20-17(23)27)8-4-1-5-9-18/h2-3,6-7,10H,1,4-5,8-9,11H2,(H,20,27)(H,21,24) |
| InChIKey | CMRFZUYECJCETG-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|