C17H17N5O3 — CID 9441418
N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)quinoxaline-2-carboxamide (PubChem CID 9441418) has the molecular formula C17H17N5O3 and a molecular weight of 339.36 g/mol. Its IUPAC name is N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)quinoxaline-2-carboxamide.
| Compound Name | N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 9441418 |
| Molecular Formula | C17H17N5O3 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)quinoxaline-2-carboxamide |
| SMILES | O=C(NN1C(=O)NC2(CCCCC2)C1=O)c1cnc2ccccc2n1 |
| InChI | InChI=1S/C17H17N5O3/c23-14(13-10-18-11-6-2-3-7-12(11)19-13)21-22-15(24)17(20-16(22)25)8-4-1-5-9-17/h2-3,6-7,10H,1,4-5,8-9H2,(H,20,25)(H,21,23) |
| InChIKey | JMGJBYXUKZUBOB-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|