C20H21N5O4S — CID 22830380
N-[4-[2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl]-1,3-thiazol-2-yl]benzamide (PubChem CID 22830380) has the molecular formula C20H21N5O4S and a molecular weight of 427.49 g/mol. Its IUPAC name is N-[4-[2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl]-1,3-thiazol-2-yl]benzamide.
| Compound Name | N-[4-[2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl]-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 22830380 |
| Molecular Formula | C20H21N5O4S |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | N-[4-[2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl]-1,3-thiazol-2-yl]benzamide |
| SMILES | O=C(Cc1csc(NC(=O)c2ccccc2)n1)NN1C(=O)NC2(CCCCC2)C1=O |
| InChI | InChI=1S/C20H21N5O4S/c26-15(24-25-17(28)20(23-19(25)29)9-5-2-6-10-20)11-14-12-30-18(21-14)22-16(27)13-7-3-1-4-8-13/h1,3-4,7-8,12H,2,5-6,9-11H2,(H,23,29)(H,24,26)(H,21,22,27) |
| InChIKey | QUECYGLAPRYEKQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 120.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|