C19H15N5O2S — CID 41377838
N-[4-[2-(benzimidazol-1-ylamino)-2-oxoethyl]-1,3-thiazol-2-yl]benzamide (PubChem CID 41377838) has the molecular formula C19H15N5O2S and a molecular weight of 377.43 g/mol. Its IUPAC name is N-[4-[2-(benzimidazol-1-ylamino)-2-oxoethyl]-1,3-thiazol-2-yl]benzamide.
| Compound Name | N-[4-[2-(benzimidazol-1-ylamino)-2-oxoethyl]-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 41377838 |
| Molecular Formula | C19H15N5O2S |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | N-[4-[2-(benzimidazol-1-ylamino)-2-oxoethyl]-1,3-thiazol-2-yl]benzamide |
| SMILES | O=C(Cc1csc(NC(=O)c2ccccc2)n1)Nn1cnc2ccccc21 |
| InChI | InChI=1S/C19H15N5O2S/c25-17(23-24-12-20-15-8-4-5-9-16(15)24)10-14-11-27-19(21-14)22-18(26)13-6-2-1-3-7-13/h1-9,11-12H,10H2,(H,23,25)(H,21,22,26) |
| InChIKey | CLGDNBKPGCWMTE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |