C19H14O7 — CID 2754656
methyl 2-(3-acetyl-4,5-dihydroxy-9,10-dioxoanthracen-2-yl)acetate (PubChem CID 2754656) has the molecular formula C19H14O7 and a molecular weight of 354.31 g/mol. Its IUPAC name is methyl 2-(3-acetyl-4,5-dihydroxy-9,10-dioxoanthracen-2-yl)acetate.
| Compound Name | methyl 2-(3-acetyl-4,5-dihydroxy-9,10-dioxoanthracen-2-yl)acetate |
|---|---|
| PubChem CID | 2754656 |
| Molecular Formula | C19H14O7 |
| Molecular Weight | 354.31 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | methyl 2-(3-acetyl-4,5-dihydroxy-9,10-dioxoanthracen-2-yl)acetate |
| SMILES | COC(=O)Cc1cc2c(c(O)c1C(C)=O)C(=O)c1c(O)cccc1C2=O |
| InChI | InChI=1S/C19H14O7/c1-8(20)14-9(7-13(22)26-2)6-11-16(18(14)24)19(25)15-10(17(11)23)4-3-5-12(15)21/h3-6,21,24H,7H2,1-2H3 |
| InChIKey | XJIJYLAICXTKPT-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.31 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|