C12H30N3OP — CID 2754825
N-bis(2-methylpropylamino)phosphoryl-2-methylpropan-1-amine (PubChem CID 2754825) has the molecular formula C12H30N3OP and a molecular weight of 263.37 g/mol. Its IUPAC name is N-bis(2-methylpropylamino)phosphoryl-2-methylpropan-1-amine.
| Compound Name | N-bis(2-methylpropylamino)phosphoryl-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 2754825 |
| Molecular Formula | C12H30N3OP |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.21 |
| IUPAC Name | N-bis(2-methylpropylamino)phosphoryl-2-methylpropan-1-amine |
| SMILES | CC(C)CNP(=O)(NCC(C)C)NCC(C)C |
| InChI | InChI=1S/C12H30N3OP/c1-10(2)7-13-17(16,14-8-11(3)4)15-9-12(5)6/h10-12H,7-9H2,1-6H3,(H3,13,14,15,16) |
| InChIKey | WEGIHSDBKDJFOF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|