About 4-bromo-N-methylaniline
4-bromo-N-methylaniline (PubChem CID 2757052) has the molecular formula C7H8BrN
and a molecular weight of 186.05 g/mol. Its IUPAC name is 4-bromo-N-methylaniline.
Molecular Properties
| Compound Name | 4-bromo-N-methylaniline |
| PubChem CID | 2757052 |
| Molecular Formula | C7H8BrN |
| Molecular Weight | 186.05 g/mol |
| Exact Mass | 184.98 |
| IUPAC Name | 4-bromo-N-methylaniline |
| SMILES | CNc1ccc(Br)cc1 |
| InChI | InChI=1S/C7H8BrN/c1-9-7-4-2-6(8)3-5-7/h2-5,9H,1H3 |
| InChIKey | AYVPVDWQZAAZCM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.05 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-bromo-N-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N-methylaniline?
The IUPAC name of 4-bromo-N-methylaniline (CID 2757052) is 4-bromo-N-methylaniline.
What is the SMILES notation for 4-bromo-N-methylaniline?
The canonical SMILES for 4-bromo-N-methylaniline is CNc1ccc(Br)cc1.
What is the InChIKey of 4-bromo-N-methylaniline?
The InChIKey is AYVPVDWQZAAZCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8BrN/c1-9-7-4-2-6(8)3-5-7/h2-5,9H,1H3.
What are the key properties of 4-bromo-N-methylaniline?
4-bromo-N-methylaniline has a molecular weight of 186.05 g/mol, XLogP of 2.49, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N-methylaniline is sourced from PubChem (CID 2757052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).